C22H33NO3 — CID 91556680
1-[(4,5-dimethoxycyclohepta-1,3-dien-1-yl)methyl]-6-methoxy-8-methyl-2,3,4,7,8,9-hexahydro-1H-cyclohepta[c]pyridine (PubChem CID 91556680) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[(4,5-dimethoxycyclohepta-1,3-dien-1-yl)methyl]-6-methoxy-8-methyl-2,3,4,7,8,9-hexahydro-1H-cyclohepta[c]pyridine.
| Compound Name | 1-[(4,5-dimethoxycyclohepta-1,3-dien-1-yl)methyl]-6-methoxy-8-methyl-2,3,4,7,8,9-hexahydro-1H-cyclohepta[c]pyridine |
|---|---|
| PubChem CID | 91556680 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-[(4,5-dimethoxycyclohepta-1,3-dien-1-yl)methyl]-6-methoxy-8-methyl-2,3,4,7,8,9-hexahydro-1H-cyclohepta[c]pyridine |
| SMILES | COC1=CC2=C(CC(C)C1)C(CC1=CC=C(OC)C(OC)CC1)NCC2 |
| InChI | InChI=1S/C22H33NO3/c1-15-11-18(24-2)14-17-9-10-23-20(19(17)12-15)13-16-5-7-21(25-3)22(26-4)8-6-16/h5,7,14-15,20,22-23H,6,8-13H2,1-4H3 |
| InChIKey | HSIMNTUJJVOVPC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |