About 4-ethenyl-N,2-dimethylhept-4-en-1-imine
4-ethenyl-N,2-dimethylhept-4-en-1-imine (PubChem CID 91556772) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-ethenyl-N,2-dimethylhept-4-en-1-imine.
Molecular Properties
| Compound Name | 4-ethenyl-N,2-dimethylhept-4-en-1-imine |
| PubChem CID | 91556772 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-ethenyl-N,2-dimethylhept-4-en-1-imine |
| SMILES | C=CC(=CCC)CC(C)/C=N/C |
| InChI | InChI=1S/C11H19N/c1-5-7-11(6-2)8-10(3)9-12-4/h6-7,9-10H,2,5,8H2,1,3-4H3/b11-7?,12-9+ |
| InChIKey | MIQIBVFAWDLDLQ-QLYYFUHCSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-N,2-dimethylhept-4-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-N,2-dimethylhept-4-en-1-imine?
The IUPAC name of 4-ethenyl-N,2-dimethylhept-4-en-1-imine (CID 91556772) is 4-ethenyl-N,2-dimethylhept-4-en-1-imine.
What is the SMILES notation for 4-ethenyl-N,2-dimethylhept-4-en-1-imine?
The canonical SMILES for 4-ethenyl-N,2-dimethylhept-4-en-1-imine is C=CC(=CCC)CC(C)/C=N/C.
What is the InChIKey of 4-ethenyl-N,2-dimethylhept-4-en-1-imine?
The InChIKey is MIQIBVFAWDLDLQ-QLYYFUHCSA-N. The full InChI is InChI=1S/C11H19N/c1-5-7-11(6-2)8-10(3)9-12-4/h6-7,9-10H,2,5,8H2,1,3-4H3/b11-7?,12-9+.
What are the key properties of 4-ethenyl-N,2-dimethylhept-4-en-1-imine?
4-ethenyl-N,2-dimethylhept-4-en-1-imine has a molecular weight of 165.28 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-N,2-dimethylhept-4-en-1-imine is sourced from PubChem (CID 91556772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).