About 1,2-dimethylpyrrole;ethane;isocyanomethane
1,2-dimethylpyrrole;ethane;isocyanomethane (PubChem CID 91557342) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,2-dimethylpyrrole;ethane;isocyanomethane.
Molecular Properties
| Compound Name | 1,2-dimethylpyrrole;ethane;isocyanomethane |
| PubChem CID | 91557342 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1,2-dimethylpyrrole;ethane;isocyanomethane |
| SMILES | CC.Cc1cccn1C.[C-]#[N+]C |
| InChI | InChI=1S/C6H9N.C2H3N.C2H6/c1-6-4-3-5-7(6)2;1-3-2;1-2/h3-5H,1-2H3;1H3;1-2H3 |
| InChIKey | QOEUFAQKJBZKME-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpyrrole;ethane;isocyanomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrrole;ethane;isocyanomethane?
The IUPAC name of 1,2-dimethylpyrrole;ethane;isocyanomethane (CID 91557342) is 1,2-dimethylpyrrole;ethane;isocyanomethane.
What is the SMILES notation for 1,2-dimethylpyrrole;ethane;isocyanomethane?
The canonical SMILES for 1,2-dimethylpyrrole;ethane;isocyanomethane is CC.Cc1cccn1C.[C-]#[N+]C.
What is the InChIKey of 1,2-dimethylpyrrole;ethane;isocyanomethane?
The InChIKey is QOEUFAQKJBZKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C2H3N.C2H6/c1-6-4-3-5-7(6)2;1-3-2;1-2/h3-5H,1-2H3;1H3;1-2H3.
What are the key properties of 1,2-dimethylpyrrole;ethane;isocyanomethane?
1,2-dimethylpyrrole;ethane;isocyanomethane has a molecular weight of 166.27 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrrole;ethane;isocyanomethane is sourced from PubChem (CID 91557342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).