C26H28N2O3S2 — CID 91557563
5-[[5-(4-hexylbenzoyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 91557563) has the molecular formula C26H28N2O3S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 5-[[5-(4-hexylbenzoyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(4-hexylbenzoyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91557563 |
| Molecular Formula | C26H28N2O3S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 5-[[5-(4-hexylbenzoyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCc1ccc(C(=O)N2CCCOc3ccc(C=C4SC(=S)NC4=O)cc32)cc1 |
| InChI | InChI=1S/C26H28N2O3S2/c1-2-3-4-5-7-18-8-11-20(12-9-18)25(30)28-14-6-15-31-22-13-10-19(16-21(22)28)17-23-24(29)27-26(32)33-23/h8-13,16-17H,2-7,14-15H2,1H3,(H,27,29,32) |
| InChIKey | JRTWPXFOAQDBJQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|