C20H18F5N3O2S — CID 91557619
6-[4-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol (PubChem CID 91557619) has the molecular formula C20H18F5N3O2S and a molecular weight of 459.44 g/mol. Its IUPAC name is 6-[4-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol.
| Compound Name | 6-[4-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 91557619 |
| Molecular Formula | C20H18F5N3O2S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 6-[4-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol |
| SMILES | Oc1cc(N2CCN(Cc3ccc(OC(F)(F)C(F)(F)F)cc3)CC2)cc2scnc12 |
| InChI | InChI=1S/C20H18F5N3O2S/c21-19(22,23)20(24,25)30-15-3-1-13(2-4-15)11-27-5-7-28(8-6-27)14-9-16(29)18-17(10-14)31-12-26-18/h1-4,9-10,12,29H,5-8,11H2 |
| InChIKey | LJESYUSRHVNSRT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|