C25H27FN4O7S3 — CID 91557718
N-[[3-[(1R,8S)-3-[(4-fluoro-3-methoxyphenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 91557718) has the molecular formula C25H27FN4O7S3 and a molecular weight of 610.71 g/mol. Its IUPAC name is N-[[3-[(1R,8S)-3-[(4-fluoro-3-methoxyphenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[(1R,8S)-3-[(4-fluoro-3-methoxyphenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91557718 |
| Molecular Formula | C25H27FN4O7S3 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | N-[[3-[(1R,8S)-3-[(4-fluoro-3-methoxyphenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | COc1cc(CN2C(=O)C(C3=NS(=O)(=O)c4c(CNS(C)(=O)=O)csc4N3)C(=O)C3C2[C@@H]2CC[C@H]3C2)ccc1F |
| InChI | InChI=1S/C25H27FN4O7S3/c1-37-17-7-12(3-6-16(17)26)10-30-20-14-5-4-13(8-14)18(20)21(31)19(25(30)32)23-28-24-22(40(35,36)29-23)15(11-38-24)9-27-39(2,33)34/h3,6-7,11,13-14,18-20,27H,4-5,8-10H2,1-2H3,(H,28,29)/t13-,14+,18?,19?,20?/m0/s1 |
| InChIKey | BAXDDACTUVXIKD-QKQRVXEOSA-N |
| XLogP | 2.10 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|