About spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane]
spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] (PubChem CID 91557907) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane].
Molecular Properties
| Compound Name | spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] |
| PubChem CID | 91557907 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)CCNC21CCCC1 |
| InChI | InChI=1S/C13H17N/c1-2-6-12-11(5-1)7-10-14-13(12)8-3-4-9-13/h1-2,5-6,14H,3-4,7-10H2 |
| InChIKey | IYFCZCVFISKZNC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane]?
The IUPAC name of spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] (CID 91557907) is spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane].
What is the SMILES notation for spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane]?
The canonical SMILES for spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] is c1ccc2c(c1)CCNC21CCCC1.
What is the InChIKey of spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane]?
The InChIKey is IYFCZCVFISKZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-2-6-12-11(5-1)7-10-14-13(12)8-3-4-9-13/h1-2,5-6,14H,3-4,7-10H2.
What are the key properties of spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane]?
spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] has a molecular weight of 187.29 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopentane] is sourced from PubChem (CID 91557907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).