About 2-(2,6-difluorophenoxy)-1,3-oxazole
2-(2,6-difluorophenoxy)-1,3-oxazole (PubChem CID 91558436) has the molecular formula C9H5F2NO2
and a molecular weight of 197.14 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenoxy)-1,3-oxazole |
| PubChem CID | 91558436 |
| Molecular Formula | C9H5F2NO2 |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-1,3-oxazole |
| SMILES | Fc1cccc(F)c1Oc1ncco1 |
| InChI | InChI=1S/C9H5F2NO2/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-5H |
| InChIKey | LUFUIFPGMWMBPW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-difluorophenoxy)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenoxy)-1,3-oxazole?
The IUPAC name of 2-(2,6-difluorophenoxy)-1,3-oxazole (CID 91558436) is 2-(2,6-difluorophenoxy)-1,3-oxazole.
What is the SMILES notation for 2-(2,6-difluorophenoxy)-1,3-oxazole?
The canonical SMILES for 2-(2,6-difluorophenoxy)-1,3-oxazole is Fc1cccc(F)c1Oc1ncco1.
What is the InChIKey of 2-(2,6-difluorophenoxy)-1,3-oxazole?
The InChIKey is LUFUIFPGMWMBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2NO2/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-5H.
What are the key properties of 2-(2,6-difluorophenoxy)-1,3-oxazole?
2-(2,6-difluorophenoxy)-1,3-oxazole has a molecular weight of 197.14 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenoxy)-1,3-oxazole is sourced from PubChem (CID 91558436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).