C22H21F3O2 — CID 91558492
4-hydroxy-3-[2-methyl-5-[2-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octan-2-one (PubChem CID 91558492) has the molecular formula C22H21F3O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-hydroxy-3-[2-methyl-5-[2-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octan-2-one.
| Compound Name | 4-hydroxy-3-[2-methyl-5-[2-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 91558492 |
| Molecular Formula | C22H21F3O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-hydroxy-3-[2-methyl-5-[2-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octan-2-one |
| SMILES | Cc1ccc(-c2ccccc2C(F)(F)F)cc1C1C(=O)C2CCC(C2)C1O |
| InChI | InChI=1S/C22H21F3O2/c1-12-6-7-13(16-4-2-3-5-18(16)22(23,24)25)11-17(12)19-20(26)14-8-9-15(10-14)21(19)27/h2-7,11,14-15,19-20,26H,8-10H2,1H3 |
| InChIKey | GRAMXKPZLCIHTN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |