C33H35FN4O2 — CID 91559223
2-(4-fluorophenyl)-6-[3-[[(1-hepta-3,5-dien-3-ylcyclopropyl)amino]-methoxymethyl]phenyl]-N-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 91559223) has the molecular formula C33H35FN4O2 and a molecular weight of 538.67 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-[3-[[(1-hepta-3,5-dien-3-ylcyclopropyl)amino]-methoxymethyl]phenyl]-N-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-6-[3-[[(1-hepta-3,5-dien-3-ylcyclopropyl)amino]-methoxymethyl]phenyl]-N-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91559223 |
| Molecular Formula | C33H35FN4O2 |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-(4-fluorophenyl)-6-[3-[[(1-hepta-3,5-dien-3-ylcyclopropyl)amino]-methoxymethyl]phenyl]-N-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CC=CC=C(CC)C1(NC(OC)c2cccc(-c3ccc4nc(-c5ccc(F)cc5)c(C(=O)NC)n4c3)c2)CC1 |
| InChI | InChI=1S/C33H35FN4O2/c1-5-7-11-26(6-2)33(18-19-33)37-32(40-4)24-10-8-9-23(20-24)25-14-17-28-36-29(22-12-15-27(34)16-13-22)30(31(39)35-3)38(28)21-25/h5,7-17,20-21,32,37H,6,18-19H2,1-4H3,(H,35,39) |
| InChIKey | AMIXGGRUASGJSG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|