About [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone
[3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone (PubChem CID 91559573) has the molecular formula C23H21N3O2S
and a molecular weight of 403.51 g/mol. Its IUPAC name is [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone.
Molecular Properties
| Compound Name | [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone |
| PubChem CID | 91559573 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone |
| SMILES | CN(c1nc2ccccc2o1)C1CCN(C(=O)c2ccccc2-c2cccs2)C1 |
| InChI | InChI=1S/C23H21N3O2S/c1-25(23-24-19-9-4-5-10-20(19)28-23)16-12-13-26(15-16)22(27)18-8-3-2-7-17(18)21-11-6-14-29-21/h2-11,14,16H,12-13,15H2,1H3 |
| InChIKey | HBQDBQSSPBXOOT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone?
The IUPAC name of [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone (CID 91559573) is [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone.
What is the SMILES notation for [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone?
The canonical SMILES for [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone is CN(c1nc2ccccc2o1)C1CCN(C(=O)c2ccccc2-c2cccs2)C1.
What is the InChIKey of [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone?
The InChIKey is HBQDBQSSPBXOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O2S/c1-25(23-24-19-9-4-5-10-20(19)28-23)16-12-13-26(15-16)22(27)18-8-3-2-7-17(18)21-11-6-14-29-21/h2-11,14,16H,12-13,15H2,1H3.
What are the key properties of [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone?
[3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone has a molecular weight of 403.51 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1,3-benzoxazol-2-yl(methyl)amino]pyrrolidin-1-yl]-(2-thiophen-2-ylphenyl)methanone is sourced from PubChem (CID 91559573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).