About ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile
ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile (PubChem CID 91559664) has the molecular formula C11H25NO5S
and a molecular weight of 283.39 g/mol. Its IUPAC name is ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile.
Molecular Properties
| Compound Name | ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile |
| PubChem CID | 91559664 |
| Molecular Formula | C11H25NO5S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile |
| SMILES | CCOCC.CCOOCC.CS(=O)(=O)CC#N |
| InChI | InChI=1S/C4H10O2.C4H10O.C3H5NO2S/c1-3-5-6-4-2;1-3-5-4-2;1-7(5,6)3-2-4/h3-4H2,1-2H3;3-4H2,1-2H3;3H2,1H3 |
| InChIKey | JMVLHPLNXBXACI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile?
The IUPAC name of ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile (CID 91559664) is ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile.
What is the SMILES notation for ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile?
The canonical SMILES for ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile is CCOCC.CCOOCC.CS(=O)(=O)CC#N.
What is the InChIKey of ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile?
The InChIKey is JMVLHPLNXBXACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C4H10O.C3H5NO2S/c1-3-5-6-4-2;1-3-5-4-2;1-7(5,6)3-2-4/h3-4H2,1-2H3;3-4H2,1-2H3;3H2,1H3.
What are the key properties of ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile?
ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile has a molecular weight of 283.39 g/mol, XLogP of 1.57, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;ethylperoxyethane;2-methylsulfonylacetonitrile is sourced from PubChem (CID 91559664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).