C10H10F3NO5S — CID 91559939
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) trifluoromethanesulfonate (PubChem CID 91559939) has the molecular formula C10H10F3NO5S and a molecular weight of 313.25 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) trifluoromethanesulfonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91559939 |
| Molecular Formula | C10H10F3NO5S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1CCC2C1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO5S/c11-10(12,13)20(17,18)19-14-8(15)6-4-1-2-5(3-4)7(6)9(14)16/h4-5,15-16H,1-3H2 |
| InChIKey | PUZXFQMAOGWOEK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|