C8H12N2 — CID 91560605
3,4,4a,5,6,8a-hexahydrocinnoline (PubChem CID 91560605) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 3,4,4a,5,6,8a-hexahydrocinnoline.
| Compound Name | 3,4,4a,5,6,8a-hexahydrocinnoline |
|---|---|
| PubChem CID | 91560605 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3,4,4a,5,6,8a-hexahydrocinnoline |
| SMILES | C1=CC2N=NCCC2CC1 |
| InChI | InChI=1S/C8H12N2/c1-2-4-8-7(3-1)5-6-9-10-8/h2,4,7-8H,1,3,5-6H2 |
| InChIKey | KNOIGHTVLHEVEH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|