C14H18N2 — CID 91561084
5,9-dimethyl-1,2,4a,8,10a,10b-hexahydro-1,10-phenanthroline (PubChem CID 91561084) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5,9-dimethyl-1,2,4a,8,10a,10b-hexahydro-1,10-phenanthroline.
| Compound Name | 5,9-dimethyl-1,2,4a,8,10a,10b-hexahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 91561084 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 5,9-dimethyl-1,2,4a,8,10a,10b-hexahydro-1,10-phenanthroline |
| SMILES | CC1=CC2=CCC(C)=NC2C2NCC=CC12 |
| InChI | InChI=1S/C14H18N2/c1-9-8-11-6-5-10(2)16-13(11)14-12(9)4-3-7-15-14/h3-4,6,8,12-15H,5,7H2,1-2H3 |
| InChIKey | LZQNGVNFONIBHL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|