C24H38N2O — CID 91561221
6-(3-methyliminopropyl)-5-(4-prop-2-enyl-3-propylhept-5-enyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 91561221) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is 6-(3-methyliminopropyl)-5-(4-prop-2-enyl-3-propylhept-5-enyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-(3-methyliminopropyl)-5-(4-prop-2-enyl-3-propylhept-5-enyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 91561221 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 6-(3-methyliminopropyl)-5-(4-prop-2-enyl-3-propylhept-5-enyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | C=CCC(C=CC)C(CCC)CCC1C=CC=C(C(N)=O)C1CC/C=N/C |
| InChI | InChI=1S/C24H38N2O/c1-5-10-19(11-6-2)20(12-7-3)16-17-21-13-8-14-23(24(25)27)22(21)15-9-18-26-4/h5-6,8,11,13-14,18-22H,1,7,9-10,12,15-17H2,2-4H3,(H2,25,27)/b11-6?,26-18+ |
| InChIKey | XRVPMNQBQGYWCF-XMUDGKDZSA-N |
| XLogP | 5.65 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|