C15H14F9NO5S — CID 91561359
(3,5-dihydroxy-8,9-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 91561359) has the molecular formula C15H14F9NO5S and a molecular weight of 491.33 g/mol. Its IUPAC name is (3,5-dihydroxy-8,9-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (3,5-dihydroxy-8,9-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 91561359 |
| Molecular Formula | C15H14F9NO5S |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | (3,5-dihydroxy-8,9-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC1C2CC(c3c2c(O)n(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c3O)C1C |
| InChI | InChI=1S/C15H14F9NO5S/c1-4-5(2)7-3-6(4)8-9(7)11(27)25(10(8)26)30-31(28,29)15(23,24)13(18,19)12(16,17)14(20,21)22/h4-7,26-27H,3H2,1-2H3 |
| InChIKey | UHJBODGQMSKCOO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|