C23H26ClN2P — CID 91561420
[2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-hepta-2,4,6-trien-3-yl-phenylphosphane (PubChem CID 91561420) has the molecular formula C23H26ClN2P and a molecular weight of 396.90 g/mol. Its IUPAC name is [2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-hepta-2,4,6-trien-3-yl-phenylphosphane.
| Compound Name | [2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-hepta-2,4,6-trien-3-yl-phenylphosphane |
|---|---|
| PubChem CID | 91561420 |
| Molecular Formula | C23H26ClN2P |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-chloro-5-(1-methylpyrrolidin-2-yl)-4-pyridinyl]-hepta-2,4,6-trien-3-yl-phenylphosphane |
| SMILES | C=CC=CC(=CC)P(c1ccccc1)c1cc(Cl)ncc1C1CCCN1C |
| InChI | InChI=1S/C23H26ClN2P/c1-4-6-11-18(5-2)27(19-12-8-7-9-13-19)22-16-23(24)25-17-20(22)21-14-10-15-26(21)3/h4-9,11-13,16-17,21H,1,10,14-15H2,2-3H3 |
| InChIKey | MZGBRYCCIKTMGI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|