About 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide
5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide (PubChem CID 91562119) has the molecular formula C9H11FN2O2
and a molecular weight of 198.20 g/mol. Its IUPAC name is 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide |
| PubChem CID | 91562119 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(C)c(OCF)c1 |
| InChI | InChI=1S/C9H11FN2O2/c1-6-8(14-5-10)3-7(4-12-6)9(13)11-2/h3-4H,5H2,1-2H3,(H,11,13) |
| InChIKey | NJOQOHCPXJBTNH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide?
The IUPAC name of 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide (CID 91562119) is 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide?
The canonical SMILES for 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide is CNC(=O)c1cnc(C)c(OCF)c1.
What is the InChIKey of 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide?
The InChIKey is NJOQOHCPXJBTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O2/c1-6-8(14-5-10)3-7(4-12-6)9(13)11-2/h3-4H,5H2,1-2H3,(H,11,13).
What are the key properties of 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide?
5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide has a molecular weight of 198.20 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethoxy)-N,6-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 91562119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).