C14H10F5NS2 — CID 91562288
1,2,3,4,5-pentafluoro-6-(1-phenylethylsulfanylamino)sulfanylbenzene (PubChem CID 91562288) has the molecular formula C14H10F5NS2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(1-phenylethylsulfanylamino)sulfanylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(1-phenylethylsulfanylamino)sulfanylbenzene |
|---|---|
| PubChem CID | 91562288 |
| Molecular Formula | C14H10F5NS2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(1-phenylethylsulfanylamino)sulfanylbenzene |
| SMILES | CC(SNSc1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C14H10F5NS2/c1-7(8-5-3-2-4-6-8)21-20-22-14-12(18)10(16)9(15)11(17)13(14)19/h2-7,20H,1H3 |
| InChIKey | PXYCWLPOBNXVDT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|