C25H28N4O6S — CID 91562439
N,2-dimethyl-6-[2-[3-(3-methylsulfonylpropoxy)anilino]pyrimidin-4-yl]oxy-7,7a-dihydro-1-benzofuran-3-carboxamide (PubChem CID 91562439) has the molecular formula C25H28N4O6S and a molecular weight of 512.59 g/mol. Its IUPAC name is N,2-dimethyl-6-[2-[3-(3-methylsulfonylpropoxy)anilino]pyrimidin-4-yl]oxy-7,7a-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | N,2-dimethyl-6-[2-[3-(3-methylsulfonylpropoxy)anilino]pyrimidin-4-yl]oxy-7,7a-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 91562439 |
| Molecular Formula | C25H28N4O6S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N,2-dimethyl-6-[2-[3-(3-methylsulfonylpropoxy)anilino]pyrimidin-4-yl]oxy-7,7a-dihydro-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)C1=C(C)OC2CC(Oc3ccnc(Nc4cccc(OCCCS(C)(=O)=O)c4)n3)=CC=C12 |
| InChI | InChI=1S/C25H28N4O6S/c1-16-23(24(30)26-2)20-9-8-19(15-21(20)34-16)35-22-10-11-27-25(29-22)28-17-6-4-7-18(14-17)33-12-5-13-36(3,31)32/h4,6-11,14,21H,5,12-13,15H2,1-3H3,(H,26,30)(H,27,28,29) |
| InChIKey | XUGTZLPIIBVOMG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|