About 1-(4-aminophenyl)pyrrole-2,5-diol
1-(4-aminophenyl)pyrrole-2,5-diol (PubChem CID 91562681) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(4-aminophenyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(4-aminophenyl)pyrrole-2,5-diol |
| PubChem CID | 91562681 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(4-aminophenyl)pyrrole-2,5-diol |
| SMILES | Nc1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C10H10N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6,13-14H,11H2 |
| InChIKey | LIWFJYSWEPFDCX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminophenyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminophenyl)pyrrole-2,5-diol?
The IUPAC name of 1-(4-aminophenyl)pyrrole-2,5-diol (CID 91562681) is 1-(4-aminophenyl)pyrrole-2,5-diol.
What is the SMILES notation for 1-(4-aminophenyl)pyrrole-2,5-diol?
The canonical SMILES for 1-(4-aminophenyl)pyrrole-2,5-diol is Nc1ccc(-n2c(O)ccc2O)cc1.
What is the InChIKey of 1-(4-aminophenyl)pyrrole-2,5-diol?
The InChIKey is LIWFJYSWEPFDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6,13-14H,11H2.
What are the key properties of 1-(4-aminophenyl)pyrrole-2,5-diol?
1-(4-aminophenyl)pyrrole-2,5-diol has a molecular weight of 190.20 g/mol, XLogP of 1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenyl)pyrrole-2,5-diol is sourced from PubChem (CID 91562681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).