About ethanol;hexan-3-amine
ethanol;hexan-3-amine (PubChem CID 91562717) has the molecular formula C8H21NO
and a molecular weight of 147.26 g/mol. Its IUPAC name is ethanol;hexan-3-amine.
Molecular Properties
| Compound Name | ethanol;hexan-3-amine |
| PubChem CID | 91562717 |
| Molecular Formula | C8H21NO |
| Molecular Weight | 147.26 g/mol |
| Exact Mass | 147.16 |
| IUPAC Name | ethanol;hexan-3-amine |
| SMILES | CCCC(N)CC.CCO |
| InChI | InChI=1S/C6H15N.C2H6O/c1-3-5-6(7)4-2;1-2-3/h6H,3-5,7H2,1-2H3;3H,2H2,1H3 |
| InChIKey | STQRQNOFSFWDHL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;hexan-3-amine?
The IUPAC name of ethanol;hexan-3-amine (CID 91562717) is ethanol;hexan-3-amine.
What is the SMILES notation for ethanol;hexan-3-amine?
The canonical SMILES for ethanol;hexan-3-amine is CCCC(N)CC.CCO.
What is the InChIKey of ethanol;hexan-3-amine?
The InChIKey is STQRQNOFSFWDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6O/c1-3-5-6(7)4-2;1-2-3/h6H,3-5,7H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;hexan-3-amine?
ethanol;hexan-3-amine has a molecular weight of 147.26 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;hexan-3-amine is sourced from PubChem (CID 91562717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).