C24H27Cl2FN2O3 — CID 91562995
1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[3-(2,6-dichloro-4-fluorophenoxy)propyl]piperazine (PubChem CID 91562995) has the molecular formula C24H27Cl2FN2O3 and a molecular weight of 481.40 g/mol. Its IUPAC name is 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[3-(2,6-dichloro-4-fluorophenoxy)propyl]piperazine.
| Compound Name | 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[3-(2,6-dichloro-4-fluorophenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 91562995 |
| Molecular Formula | C24H27Cl2FN2O3 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[3-(2,6-dichloro-4-fluorophenoxy)propyl]piperazine |
| SMILES | Fc1cc(Cl)c(OCCCN2CCN(C3=COC(CC4=CC=CCC4)=CO3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2FN2O3/c25-21-14-19(27)15-22(26)24(21)30-12-4-7-28-8-10-29(11-9-28)23-17-31-20(16-32-23)13-18-5-2-1-3-6-18/h1-2,5,14-17H,3-4,6-13H2 |
| InChIKey | HJFHEJBRTMOQJI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|