C15H30O — CID 91563078
1-ethyl-2,3,4,6-tetramethyl-5-propylcyclohexan-1-ol (PubChem CID 91563078) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 1-ethyl-2,3,4,6-tetramethyl-5-propylcyclohexan-1-ol.
| Compound Name | 1-ethyl-2,3,4,6-tetramethyl-5-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 91563078 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 1-ethyl-2,3,4,6-tetramethyl-5-propylcyclohexan-1-ol |
| SMILES | CCCC1C(C)C(C)C(C)C(O)(CC)C1C |
| InChI | InChI=1S/C15H30O/c1-7-9-14-11(4)10(3)12(5)15(16,8-2)13(14)6/h10-14,16H,7-9H2,1-6H3 |
| InChIKey | DNHOFZWRJZVVNX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |