C15H21FNO+ — CID 91563292
5-(2-fluoro-3-methyl-2-prop-1-en-2-ylbut-3-enyl)-1,1-dimethylpyridin-1-ium-2-one (PubChem CID 91563292) has the molecular formula C15H21FNO+ and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(2-fluoro-3-methyl-2-prop-1-en-2-ylbut-3-enyl)-1,1-dimethylpyridin-1-ium-2-one.
| Compound Name | 5-(2-fluoro-3-methyl-2-prop-1-en-2-ylbut-3-enyl)-1,1-dimethylpyridin-1-ium-2-one |
|---|---|
| PubChem CID | 91563292 |
| Molecular Formula | C15H21FNO+ |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5-(2-fluoro-3-methyl-2-prop-1-en-2-ylbut-3-enyl)-1,1-dimethylpyridin-1-ium-2-one |
| SMILES | C=C(C)C(F)(CC1=C[N+](C)(C)C(=O)C=C1)C(=C)C |
| InChI | InChI=1S/C15H21FNO/c1-11(2)15(16,12(3)4)9-13-7-8-14(18)17(5,6)10-13/h7-8,10H,1,3,9H2,2,4-6H3/q+1 |
| InChIKey | GFULGOCDONSTMC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|