C18H11F3N2O4 — CID 91563366
7-(1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl)-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 91563366) has the molecular formula C18H11F3N2O4 and a molecular weight of 376.29 g/mol. Its IUPAC name is 7-(1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl)-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-(1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl)-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91563366 |
| Molecular Formula | C18H11F3N2O4 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 7-(1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl)-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(-n3c(O)c4c(c3O)C3C=CC4O3)cc2[nH]1 |
| InChI | InChI=1S/C18H11F3N2O4/c19-18(20,21)9-6-13(24)22-10-5-7(1-2-8(9)10)23-16(25)14-11-3-4-12(27-11)15(14)17(23)26/h1-6,11-12,25-26H,(H,22,24) |
| InChIKey | KPPZBOMTUDAQDZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|