C16H17N5O3 — CID 91563381
(4S)-4-amino-2-benzyl-2-(diazomethyl)-5-(1H-imidazol-5-yl)-3-oxopentanoic acid (PubChem CID 91563381) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is (4S)-4-amino-2-benzyl-2-(diazomethyl)-5-(1H-imidazol-5-yl)-3-oxopentanoic acid.
| Compound Name | (4S)-4-amino-2-benzyl-2-(diazomethyl)-5-(1H-imidazol-5-yl)-3-oxopentanoic acid |
|---|---|
| PubChem CID | 91563381 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (4S)-4-amino-2-benzyl-2-(diazomethyl)-5-(1H-imidazol-5-yl)-3-oxopentanoic acid |
| SMILES | [N-]=[N+]=CC(Cc1ccccc1)(C(=O)O)C(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C16H17N5O3/c17-13(6-12-8-19-10-20-12)14(22)16(9-21-18,15(23)24)7-11-4-2-1-3-5-11/h1-5,8-10,13H,6-7,17H2,(H,19,20)(H,23,24)/t13-,16?/m0/s1 |
| InChIKey | OLVIPEMKFHINOK-KNVGNIICSA-N |
| XLogP | 0.46 |
| TPSA | 145.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|