About (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one
(2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one (PubChem CID 91563713) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one |
| PubChem CID | 91563713 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one |
| SMILES | CC=CC(C)=C[C@H](C)[C@@H]1CC=C(OC)C(=O)O1 |
| InChI | InChI=1S/C14H20O3/c1-5-6-10(2)9-11(3)12-7-8-13(16-4)14(15)17-12/h5-6,8-9,11-12H,7H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | OCYKKNOLUCMESA-RYUDHWBXSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one?
The IUPAC name of (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one (CID 91563713) is (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one?
The canonical SMILES for (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one is CC=CC(C)=C[C@H](C)[C@@H]1CC=C(OC)C(=O)O1.
What is the InChIKey of (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one?
The InChIKey is OCYKKNOLUCMESA-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H20O3/c1-5-6-10(2)9-11(3)12-7-8-13(16-4)14(15)17-12/h5-6,8-9,11-12H,7H2,1-4H3/t11-,12-/m0/s1.
What are the key properties of (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one?
(2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one has a molecular weight of 236.31 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-methoxy-2-[(2S)-4-methylhepta-3,5-dien-2-yl]-2,3-dihydropyran-6-one is sourced from PubChem (CID 91563713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).