C21H17BrFN3O2S — CID 91563811
4-(4-bromo-2-fluorophenyl)-3-isocyano-N-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carboxamide (PubChem CID 91563811) has the molecular formula C21H17BrFN3O2S and a molecular weight of 474.36 g/mol. Its IUPAC name is 4-(4-bromo-2-fluorophenyl)-3-isocyano-N-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carboxamide.
| Compound Name | 4-(4-bromo-2-fluorophenyl)-3-isocyano-N-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 91563811 |
| Molecular Formula | C21H17BrFN3O2S |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 4-(4-bromo-2-fluorophenyl)-3-isocyano-N-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyridine-5-carboxamide |
| SMILES | [C-]#[N+]C1C(=S)NC(C)=C(C(=O)Nc2ccccc2OC)C1c1ccc(Br)cc1F |
| InChI | InChI=1S/C21H17BrFN3O2S/c1-11-17(20(27)26-15-6-4-5-7-16(15)28-3)18(19(24-2)21(29)25-11)13-9-8-12(22)10-14(13)23/h4-10,18-19H,1,3H3,(H,25,29)(H,26,27) |
| InChIKey | VPXWFAJJGLOUCS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|