C10H13F7O — CID 91564501
1-ethoxy-3-ethyl-4,4,5,5,6,6,6-heptafluorohex-2-ene (PubChem CID 91564501) has the molecular formula C10H13F7O and a molecular weight of 282.20 g/mol. Its IUPAC name is 1-ethoxy-3-ethyl-4,4,5,5,6,6,6-heptafluorohex-2-ene.
| Compound Name | 1-ethoxy-3-ethyl-4,4,5,5,6,6,6-heptafluorohex-2-ene |
|---|---|
| PubChem CID | 91564501 |
| Molecular Formula | C10H13F7O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-ethoxy-3-ethyl-4,4,5,5,6,6,6-heptafluorohex-2-ene |
| SMILES | CCOCC=C(CC)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7O/c1-3-7(5-6-18-4-2)8(11,12)9(13,14)10(15,16)17/h5H,3-4,6H2,1-2H3 |
| InChIKey | HRGVBZKQCOKUKN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|