C22H16F2N2O2 — CID 91564827
4,4-bis(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-one (PubChem CID 91564827) has the molecular formula C22H16F2N2O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-one.
| Compound Name | 4,4-bis(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 91564827 |
| Molecular Formula | C22H16F2N2O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-one |
| SMILES | COc1ccc(C2=NC(c3ccc(F)cc3)(c3ccc(F)cc3)C(=O)N2)cc1 |
| InChI | InChI=1S/C22H16F2N2O2/c1-28-19-12-2-14(3-13-19)20-25-21(27)22(26-20,15-4-8-17(23)9-5-15)16-6-10-18(24)11-7-16/h2-13H,1H3,(H,25,26,27) |
| InChIKey | KUBWYFNIBJDQOE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |