C6H8N6O2 — CID 91564913
8-[amino(hydroxy)methyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one (PubChem CID 91564913) has the molecular formula C6H8N6O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is 8-[amino(hydroxy)methyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one.
| Compound Name | 8-[amino(hydroxy)methyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
|---|---|
| PubChem CID | 91564913 |
| Molecular Formula | C6H8N6O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 8-[amino(hydroxy)methyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| SMILES | Cn1nnc2c(C(N)O)ncn2c1=O |
| InChI | InChI=1S/C6H8N6O2/c1-11-6(14)12-2-8-3(4(7)13)5(12)9-10-11/h2,4,13H,7H2,1H3 |
| InChIKey | BNLDPKUUYRNURL-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|