C24H12F8N2 — CID 91565091
4-[[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(pyridin-4-ylmethyl)phenyl]phenyl]methyl]pyridine (PubChem CID 91565091) has the molecular formula C24H12F8N2 and a molecular weight of 480.36 g/mol. Its IUPAC name is 4-[[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(pyridin-4-ylmethyl)phenyl]phenyl]methyl]pyridine.
| Compound Name | 4-[[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(pyridin-4-ylmethyl)phenyl]phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 91565091 |
| Molecular Formula | C24H12F8N2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 4-[[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(pyridin-4-ylmethyl)phenyl]phenyl]methyl]pyridine |
| SMILES | Fc1c(F)c(-c2c(F)c(F)c(Cc3ccncc3)c(F)c2F)c(F)c(F)c1Cc1ccncc1 |
| InChI | InChI=1S/C24H12F8N2/c25-17-13(9-11-1-5-33-6-2-11)18(26)22(30)15(21(17)29)16-23(31)19(27)14(20(28)24(16)32)10-12-3-7-34-8-4-12/h1-8H,9-10H2 |
| InChIKey | MSXJKENXFUGKOV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|