C21H22FN3O3 — CID 9156547
N-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 9156547) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 9156547 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN(Cc1ccccc1F)C(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-24(14-16-5-2-3-6-18(16)22)20(27)13-23-21(28)15-8-10-17(11-9-15)25-12-4-7-19(25)26/h2-3,5-6,8-11H,4,7,12-14H2,1H3,(H,23,28) |
| InChIKey | YEVNSFHWXNXIBU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |