About 6,6-dimethylcyclohept-2-ene-1,4-diimine
6,6-dimethylcyclohept-2-ene-1,4-diimine (PubChem CID 91566024) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 6,6-dimethylcyclohept-2-ene-1,4-diimine.
Molecular Properties
| Compound Name | 6,6-dimethylcyclohept-2-ene-1,4-diimine |
| PubChem CID | 91566024 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6,6-dimethylcyclohept-2-ene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])CC(C)(C)C1 |
| InChI | InChI=1S/C9H14N2/c1-9(2)5-7(10)3-4-8(11)6-9/h3-4,10-11H,5-6H2,1-2H3/b10-7+,11-8+ |
| InChIKey | YDZUMFFAKDGBAK-AMMQDNIMSA-N |
| XLogP | 2.40 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethylcyclohept-2-ene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylcyclohept-2-ene-1,4-diimine?
The IUPAC name of 6,6-dimethylcyclohept-2-ene-1,4-diimine (CID 91566024) is 6,6-dimethylcyclohept-2-ene-1,4-diimine.
What is the SMILES notation for 6,6-dimethylcyclohept-2-ene-1,4-diimine?
The canonical SMILES for 6,6-dimethylcyclohept-2-ene-1,4-diimine is [H]/N=C1\C=C/C(=N\[H])CC(C)(C)C1.
What is the InChIKey of 6,6-dimethylcyclohept-2-ene-1,4-diimine?
The InChIKey is YDZUMFFAKDGBAK-AMMQDNIMSA-N. The full InChI is InChI=1S/C9H14N2/c1-9(2)5-7(10)3-4-8(11)6-9/h3-4,10-11H,5-6H2,1-2H3/b10-7+,11-8+.
What are the key properties of 6,6-dimethylcyclohept-2-ene-1,4-diimine?
6,6-dimethylcyclohept-2-ene-1,4-diimine has a molecular weight of 150.23 g/mol, XLogP of 2.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylcyclohept-2-ene-1,4-diimine is sourced from PubChem (CID 91566024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).