C41H32F8O3S2-2 — CID 91566235
fluoro-dioxido-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfane;(2,2,3,3,4,4,5-heptafluoro-1,1-diphenylpentyl)benzene (PubChem CID 91566235) has the molecular formula C41H32F8O3S2-2 and a molecular weight of 788.82 g/mol. Its IUPAC name is fluoro-dioxido-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfane;(2,2,3,3,4,4,5-heptafluoro-1,1-diphenylpentyl)benzene.
| Compound Name | fluoro-dioxido-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfane;(2,2,3,3,4,4,5-heptafluoro-1,1-diphenylpentyl)benzene |
|---|---|
| PubChem CID | 91566235 |
| Molecular Formula | C41H32F8O3S2-2 |
| Molecular Weight | 788.82 g/mol |
| Exact Mass | 788.17 |
| IUPAC Name | fluoro-dioxido-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfane;(2,2,3,3,4,4,5-heptafluoro-1,1-diphenylpentyl)benzene |
| SMILES | FCC(F)(F)C(F)(F)C(F)(F)C(c1ccccc1)(c1ccccc1)c1ccccc1.O=S([O-])([O-])(F)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17F7.C18H17FO3S2/c24-16-20(25,26)22(27,28)23(29,30)21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;19-24(20,21,22)23(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,16H2;1-15H,(H2,20,21,22)/p-2 |
| InChIKey | BHYKPKMOGUSXLU-UHFFFAOYSA-L |
| XLogP | 11.75 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.82 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|