About 7,7-dimethoxy-2,2-dimethyl-8H-chromene
7,7-dimethoxy-2,2-dimethyl-8H-chromene (PubChem CID 91566289) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 7,7-dimethoxy-2,2-dimethyl-8H-chromene.
Molecular Properties
| Compound Name | 7,7-dimethoxy-2,2-dimethyl-8H-chromene |
| PubChem CID | 91566289 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 7,7-dimethoxy-2,2-dimethyl-8H-chromene |
| SMILES | COC1(OC)C=CC2=C(C1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C13H18O3/c1-12(2)7-5-10-6-8-13(14-3,15-4)9-11(10)16-12/h5-8H,9H2,1-4H3 |
| InChIKey | LQTUCAROPSMYIM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethoxy-2,2-dimethyl-8H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethoxy-2,2-dimethyl-8H-chromene?
The IUPAC name of 7,7-dimethoxy-2,2-dimethyl-8H-chromene (CID 91566289) is 7,7-dimethoxy-2,2-dimethyl-8H-chromene.
What is the SMILES notation for 7,7-dimethoxy-2,2-dimethyl-8H-chromene?
The canonical SMILES for 7,7-dimethoxy-2,2-dimethyl-8H-chromene is COC1(OC)C=CC2=C(C1)OC(C)(C)C=C2.
What is the InChIKey of 7,7-dimethoxy-2,2-dimethyl-8H-chromene?
The InChIKey is LQTUCAROPSMYIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-12(2)7-5-10-6-8-13(14-3,15-4)9-11(10)16-12/h5-8H,9H2,1-4H3.
What are the key properties of 7,7-dimethoxy-2,2-dimethyl-8H-chromene?
7,7-dimethoxy-2,2-dimethyl-8H-chromene has a molecular weight of 222.28 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethoxy-2,2-dimethyl-8H-chromene is sourced from PubChem (CID 91566289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).