C26H26N4O — CID 91566746
2-[N-ethyl-4-(3-phenyl-N-pyrimidin-4-ylanilino)anilino]ethanol (PubChem CID 91566746) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[N-ethyl-4-(3-phenyl-N-pyrimidin-4-ylanilino)anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-(3-phenyl-N-pyrimidin-4-ylanilino)anilino]ethanol |
|---|---|
| PubChem CID | 91566746 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[N-ethyl-4-(3-phenyl-N-pyrimidin-4-ylanilino)anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(N(c2cccc(-c3ccccc3)c2)c2ccncn2)cc1 |
| InChI | InChI=1S/C26H26N4O/c1-2-29(17-18-31)23-11-13-24(14-12-23)30(26-15-16-27-20-28-26)25-10-6-9-22(19-25)21-7-4-3-5-8-21/h3-16,19-20,31H,2,17-18H2,1H3 |
| InChIKey | QUTICPQAVBYSOB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|