C27H35ClN2O5S — CID 91566797
2-(2-chlorophenyl)ethyl N-tert-butyl-N-[5-oxo-5-(7-sulfamoyl-2,3-dihydro-1H-inden-5-yl)pentyl]carbamate (PubChem CID 91566797) has the molecular formula C27H35ClN2O5S and a molecular weight of 535.11 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl N-tert-butyl-N-[5-oxo-5-(7-sulfamoyl-2,3-dihydro-1H-inden-5-yl)pentyl]carbamate.
| Compound Name | 2-(2-chlorophenyl)ethyl N-tert-butyl-N-[5-oxo-5-(7-sulfamoyl-2,3-dihydro-1H-inden-5-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 91566797 |
| Molecular Formula | C27H35ClN2O5S |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl N-tert-butyl-N-[5-oxo-5-(7-sulfamoyl-2,3-dihydro-1H-inden-5-yl)pentyl]carbamate |
| SMILES | CC(C)(C)N(CCCCC(=O)c1cc2c(c(S(N)(=O)=O)c1)CCC2)C(=O)OCCc1ccccc1Cl |
| InChI | InChI=1S/C27H35ClN2O5S/c1-27(2,3)30(26(32)35-16-14-19-9-4-5-12-23(19)28)15-7-6-13-24(31)21-17-20-10-8-11-22(20)25(18-21)36(29,33)34/h4-5,9,12,17-18H,6-8,10-11,13-16H2,1-3H3,(H2,29,33,34) |
| InChIKey | HGQABKTYKJHMMG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|