C34H56F6O4Si — CID 91567144
1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]benzene;trimethylsilylmethyl 2,2-dimethylbutanoate (PubChem CID 91567144) has the molecular formula C34H56F6O4Si and a molecular weight of 670.89 g/mol. Its IUPAC name is 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]benzene;trimethylsilylmethyl 2,2-dimethylbutanoate.
| Compound Name | 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]benzene;trimethylsilylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91567144 |
| Molecular Formula | C34H56F6O4Si |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | 1-butan-2-yl-4-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]benzene;trimethylsilylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC[Si](C)(C)C.CCC(C)c1ccc(C(OCOC2CC(C)CCC2C(C)C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H34F6O2.C10H22O2Si/c1-6-17(5)18-8-10-19(11-9-18)22(23(25,26)27,24(28,29)30)32-14-31-21-13-16(4)7-12-20(21)15(2)3;1-7-10(2,3)9(11)12-8-13(4,5)6/h8-11,15-17,20-21H,6-7,12-14H2,1-5H3;7-8H2,1-6H3 |
| InChIKey | RXDPYARXUUFWLP-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|