About 4H-[1,3]thiazolo[5,4-b]pyridin-7-one
4H-[1,3]thiazolo[5,4-b]pyridin-7-one (PubChem CID 91567326) has the molecular formula C6H4N2OS
and a molecular weight of 152.18 g/mol. Its IUPAC name is 4H-[1,3]thiazolo[5,4-b]pyridin-7-one.
Molecular Properties
| Compound Name | 4H-[1,3]thiazolo[5,4-b]pyridin-7-one |
| PubChem CID | 91567326 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | 4H-[1,3]thiazolo[5,4-b]pyridin-7-one |
| SMILES | O=c1cc[nH]c2scnc12 |
| InChI | InChI=1S/C6H4N2OS/c9-4-1-2-7-6-5(4)8-3-10-6/h1-3H,(H,7,9) |
| InChIKey | ZESWMSTWLCWSJR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-[1,3]thiazolo[5,4-b]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-[1,3]thiazolo[5,4-b]pyridin-7-one?
The IUPAC name of 4H-[1,3]thiazolo[5,4-b]pyridin-7-one (CID 91567326) is 4H-[1,3]thiazolo[5,4-b]pyridin-7-one.
What is the SMILES notation for 4H-[1,3]thiazolo[5,4-b]pyridin-7-one?
The canonical SMILES for 4H-[1,3]thiazolo[5,4-b]pyridin-7-one is O=c1cc[nH]c2scnc12.
What is the InChIKey of 4H-[1,3]thiazolo[5,4-b]pyridin-7-one?
The InChIKey is ZESWMSTWLCWSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OS/c9-4-1-2-7-6-5(4)8-3-10-6/h1-3H,(H,7,9).
What are the key properties of 4H-[1,3]thiazolo[5,4-b]pyridin-7-one?
4H-[1,3]thiazolo[5,4-b]pyridin-7-one has a molecular weight of 152.18 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-[1,3]thiazolo[5,4-b]pyridin-7-one is sourced from PubChem (CID 91567326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).