About 5-ethenyl-3,4-dihydro-2H-pentalen-1-one
5-ethenyl-3,4-dihydro-2H-pentalen-1-one (PubChem CID 91567543) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-ethenyl-3,4-dihydro-2H-pentalen-1-one.
Molecular Properties
| Compound Name | 5-ethenyl-3,4-dihydro-2H-pentalen-1-one |
| PubChem CID | 91567543 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 5-ethenyl-3,4-dihydro-2H-pentalen-1-one |
| SMILES | C=CC1=CC2=C(CCC2=O)C1 |
| InChI | InChI=1S/C10H10O/c1-2-7-5-8-3-4-10(11)9(8)6-7/h2,6H,1,3-5H2 |
| InChIKey | PYCCZSXSOQWRKP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-3,4-dihydro-2H-pentalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3,4-dihydro-2H-pentalen-1-one?
The IUPAC name of 5-ethenyl-3,4-dihydro-2H-pentalen-1-one (CID 91567543) is 5-ethenyl-3,4-dihydro-2H-pentalen-1-one.
What is the SMILES notation for 5-ethenyl-3,4-dihydro-2H-pentalen-1-one?
The canonical SMILES for 5-ethenyl-3,4-dihydro-2H-pentalen-1-one is C=CC1=CC2=C(CCC2=O)C1.
What is the InChIKey of 5-ethenyl-3,4-dihydro-2H-pentalen-1-one?
The InChIKey is PYCCZSXSOQWRKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-2-7-5-8-3-4-10(11)9(8)6-7/h2,6H,1,3-5H2.
What are the key properties of 5-ethenyl-3,4-dihydro-2H-pentalen-1-one?
5-ethenyl-3,4-dihydro-2H-pentalen-1-one has a molecular weight of 146.19 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3,4-dihydro-2H-pentalen-1-one is sourced from PubChem (CID 91567543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).