About 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid
4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid (PubChem CID 91567831) has the molecular formula C20H17N3O6
and a molecular weight of 395.37 g/mol. Its IUPAC name is 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid |
| PubChem CID | 91567831 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)Nc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C20H17N3O6/c1-27-16-11-17(28-2)23-20(22-16)29-15-6-4-3-5-14(15)18(24)21-13-9-7-12(8-10-13)19(25)26/h3-11H,1-2H3,(H,21,24)(H,25,26) |
| InChIKey | GIHOLFRVVASKQA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid?
The IUPAC name of 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid (CID 91567831) is 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid.
What is the SMILES notation for 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid?
The canonical SMILES for 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid is COc1cc(OC)nc(Oc2ccccc2C(=O)Nc2ccc(C(=O)O)cc2)n1.
What is the InChIKey of 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid?
The InChIKey is GIHOLFRVVASKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O6/c1-27-16-11-17(28-2)23-20(22-16)29-15-6-4-3-5-14(15)18(24)21-13-9-7-12(8-10-13)19(25)26/h3-11H,1-2H3,(H,21,24)(H,25,26).
What are the key properties of 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid?
4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid has a molecular weight of 395.37 g/mol, XLogP of 3.24, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]benzoic acid is sourced from PubChem (CID 91567831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).