C37H41N5O2 — CID 91568173
tert-butyl N-[2-[3-ethyl-3-methyl-1-[4-[4-methyl-11-(3-methylphenyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]cyclobutyl]ethylidene]carbamate (PubChem CID 91568173) has the molecular formula C37H41N5O2 and a molecular weight of 587.77 g/mol. Its IUPAC name is tert-butyl N-[2-[3-ethyl-3-methyl-1-[4-[4-methyl-11-(3-methylphenyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]cyclobutyl]ethylidene]carbamate.
| Compound Name | tert-butyl N-[2-[3-ethyl-3-methyl-1-[4-[4-methyl-11-(3-methylphenyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]cyclobutyl]ethylidene]carbamate |
|---|---|
| PubChem CID | 91568173 |
| Molecular Formula | C37H41N5O2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | tert-butyl N-[2-[3-ethyl-3-methyl-1-[4-[4-methyl-11-(3-methylphenyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]phenyl]cyclobutyl]ethylidene]carbamate |
| SMILES | CCC1(C)CC(CC=NC(=O)OC(C)(C)C)(c2ccc(-c3nc4c(cnc5cc(C)nn54)cc3-c3cccc(C)c3)cc2)C1 |
| InChI | InChI=1S/C37H41N5O2/c1-8-36(7)22-37(23-36,16-17-38-34(43)44-35(4,5)6)29-14-12-26(13-15-29)32-30(27-11-9-10-24(2)18-27)20-28-21-39-31-19-25(3)41-42(31)33(28)40-32/h9-15,17-21H,8,16,22-23H2,1-7H3 |
| InChIKey | TZDSVZZTSCXDBJ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|