About 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol
3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol (PubChem CID 91568204) has the molecular formula C27H26N4O2
and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol |
| PubChem CID | 91568204 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol |
| SMILES | COc1ccccc1-c1c2c(C(C)(C)C)n[nH]c2c(O)n1-c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C27H26N4O2/c1-27(2,3)25-22-23(29-30-25)26(32)31(24(22)19-9-5-6-11-21(19)33-4)18-14-12-17(13-15-18)20-10-7-8-16-28-20/h5-16,29,32H,1-4H3 |
| InChIKey | ONRJQYTZSWKBPV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol?
The IUPAC name of 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol (CID 91568204) is 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol.
What is the SMILES notation for 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol?
The canonical SMILES for 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol is COc1ccccc1-c1c2c(C(C)(C)C)n[nH]c2c(O)n1-c1ccc(-c2ccccn2)cc1.
What is the InChIKey of 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol?
The InChIKey is ONRJQYTZSWKBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N4O2/c1-27(2,3)25-22-23(29-30-25)26(32)31(24(22)19-9-5-6-11-21(19)33-4)18-14-12-17(13-15-18)20-10-7-8-16-28-20/h5-16,29,32H,1-4H3.
What are the key properties of 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol?
3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol has a molecular weight of 438.53 g/mol, XLogP of 6.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-(2-methoxyphenyl)-5-(4-pyridin-2-ylphenyl)-1H-pyrrolo[3,4-c]pyrazol-6-ol is sourced from PubChem (CID 91568204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).