C14H27NO7 — CID 91568358
N-[(2S,3S,4R,5S,6R)-2-[2-(2-ethoxyethoxy)ethyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 91568358) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6R)-2-[2-(2-ethoxyethoxy)ethyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5S,6R)-2-[2-(2-ethoxyethoxy)ethyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91568358 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[(2S,3S,4R,5S,6R)-2-[2-(2-ethoxyethoxy)ethyl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CCOCCOCC[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C14H27NO7/c1-3-20-6-7-21-5-4-10-12(15-9(2)17)14(19)13(18)11(8-16)22-10/h10-14,16,18-19H,3-8H2,1-2H3,(H,15,17)/t10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | UYVXHLHLARKOMA-RYMFRWLXSA-N |
| XLogP | -1.58 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|