C11H20N2O2S — CID 91568400
2-(morpholin-4-ylmethyl)piperidine-1-carbothioic S-acid (PubChem CID 91568400) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)piperidine-1-carbothioic S-acid.
| Compound Name | 2-(morpholin-4-ylmethyl)piperidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 91568400 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)piperidine-1-carbothioic S-acid |
| SMILES | O=C(S)N1CCCCC1CN1CCOCC1 |
| InChI | InChI=1S/C11H20N2O2S/c14-11(16)13-4-2-1-3-10(13)9-12-5-7-15-8-6-12/h10H,1-9H2,(H,14,16) |
| InChIKey | SPWCIAOPZAUIEG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|