C30H34F2N7O3S+ — CID 91568428
2-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-1-ium-1-yl]ethyl N-[3-(dimethylamino)propyl]carbamate (PubChem CID 91568428) has the molecular formula C30H34F2N7O3S+ and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-1-ium-1-yl]ethyl N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | 2-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-1-ium-1-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 91568428 |
| Molecular Formula | C30H34F2N7O3S+ |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 2-[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]-1,2,4-triazol-1-ium-1-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@](O)(C[N+]1(CCOC(=O)NCCCN(C)C)C=NC=N1)c1cc(F)ccc1F |
| InChI | InChI=1S/C30H33F2N7O3S/c1-21(28-37-27(17-43-28)23-7-5-22(16-33)6-8-23)30(41,25-15-24(31)9-10-26(25)32)18-39(20-34-19-36-39)13-14-42-29(40)35-11-4-12-38(2)3/h5-10,15,17,19-21,41H,4,11-14,18H2,1-3H3/p+1/t21-,30+,39?/m0/s1 |
| InChIKey | XHONTXONXSWILQ-CYDNPPLPSA-O |
| XLogP | 4.43 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|