About 5-butyl-2-chloro-2,3-dihydrothiophene
5-butyl-2-chloro-2,3-dihydrothiophene (PubChem CID 91568490) has the molecular formula C8H13ClS
and a molecular weight of 176.71 g/mol. Its IUPAC name is 5-butyl-2-chloro-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 5-butyl-2-chloro-2,3-dihydrothiophene |
| PubChem CID | 91568490 |
| Molecular Formula | C8H13ClS |
| Molecular Weight | 176.71 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-butyl-2-chloro-2,3-dihydrothiophene |
| SMILES | CCCCC1=CCC(Cl)S1 |
| InChI | InChI=1S/C8H13ClS/c1-2-3-4-7-5-6-8(9)10-7/h5,8H,2-4,6H2,1H3 |
| InChIKey | JIFAWBINPQQNAW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-2-chloro-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-chloro-2,3-dihydrothiophene?
The IUPAC name of 5-butyl-2-chloro-2,3-dihydrothiophene (CID 91568490) is 5-butyl-2-chloro-2,3-dihydrothiophene.
What is the SMILES notation for 5-butyl-2-chloro-2,3-dihydrothiophene?
The canonical SMILES for 5-butyl-2-chloro-2,3-dihydrothiophene is CCCCC1=CCC(Cl)S1.
What is the InChIKey of 5-butyl-2-chloro-2,3-dihydrothiophene?
The InChIKey is JIFAWBINPQQNAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClS/c1-2-3-4-7-5-6-8(9)10-7/h5,8H,2-4,6H2,1H3.
What are the key properties of 5-butyl-2-chloro-2,3-dihydrothiophene?
5-butyl-2-chloro-2,3-dihydrothiophene has a molecular weight of 176.71 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-chloro-2,3-dihydrothiophene is sourced from PubChem (CID 91568490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).